EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | COc1c(O)cc2oc3cc(O)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C24H26O6/c1-12(2)6-8-14-16(25)10-19-21(22(14)27)23(28)20-15(9-7-13(3)4)24(29-5)17(26)11-18(20)30-19/h6-7,10-11,25-27H,8-9H2,1-5H3 |
| InChIKey | GNRIZKKCNOBBMO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-mangostin (CHEBI:67547) has role antimicrobial agent (CHEBI:33281) |
| α-mangostin (CHEBI:67547) has role antineoplastic agent (CHEBI:35610) |
| α-mangostin (CHEBI:67547) has role antioxidant (CHEBI:22586) |
| α-mangostin (CHEBI:67547) has role plant metabolite (CHEBI:76924) |
| α-mangostin (CHEBI:67547) is a aromatic ether (CHEBI:35618) |
| α-mangostin (CHEBI:67547) is a phenols (CHEBI:33853) |
| α-mangostin (CHEBI:67547) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| mangostin | ChemIDplus |
| 1,3,6-trihydroxy-7-methoxy-2,8-diprenylxanthone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10080 | KEGG COMPOUND |
| HMDB0035796 | HMDB |
| Mangostin | Wikipedia |
| CN102670581 | Patent |
| CN101612147 | Patent |
| C00002963 | KNApSAcK |
| MKS | PDBeChem |
| 4444969 | ChemSpider |
| FDB014546 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:362302 | Reaxys |
| CAS:6147-11-1 | ChemIDplus |
| CAS:6147-11-1 | KEGG COMPOUND |
| Citations |
|---|