EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | CC(C)=CC[C@]12OC(C)(C)[C@H]3C[C@H](C=C4C(=O)c5c(O)cc(O)cc5O[C@@]431)C2=O |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-6-22-20(27)12-7-14-19(26)18-15(25)9-13(24)10-16(18)28-23(14,22)17(8-12)21(3,4)29-22/h5,7,9-10,12,17,24-25H,6,8H2,1-4H3/t12-,17+,22+,23-/m0/s1 |
| InChIKey | XCRBRZWMQVMPIY-OJVGWFQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cochinchinoxanthone (CHEBI:67545) has role antineoplastic agent (CHEBI:35610) |
| cochinchinoxanthone (CHEBI:67545) has role metabolite (CHEBI:25212) |
| cochinchinoxanthone (CHEBI:67545) has role plant metabolite (CHEBI:76924) |
| cochinchinoxanthone (CHEBI:67545) is a cyclic ether (CHEBI:37407) |
| cochinchinoxanthone (CHEBI:67545) is a cyclic ketone (CHEBI:3992) |
| cochinchinoxanthone (CHEBI:67545) is a organic heteropentacyclic compound (CHEBI:38164) |
| cochinchinoxanthone (CHEBI:67545) is a phenols (CHEBI:33853) |
| cochinchinoxanthone (CHEBI:67545) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| (1S,3aR,5R,12aR)-8,10-dihydroxy-3,3-dimethyl-1-(3-methylbut-2-en-1-yl)-3,3a,4,5-tetrahydro-7H-1,5-methanofuro[3,4-d]xanthene-7,13-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559758 | Reaxys |
| Citations |
|---|