EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | CC(C)=CC[C@]12OC(C)(C)[C@H]3C[C@H](C=C4C(=O)c5c(O)cc(O)cc5O[C@@]431)C2=O |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-6-22-20(27)12-7-14-19(26)18-15(25)9-13(24)10-16(18)28-23(14,22)17(8-12)21(3,4)29-22/h5,7,9-10,12,17,24-25H,6,8H2,1-4H3/t12-,17+,22+,23-/m0/s1 |
| InChIKey | XCRBRZWMQVMPIY-OJVGWFQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cochinchinoxanthone (CHEBI:67545) has role antineoplastic agent (CHEBI:35610) |
| cochinchinoxanthone (CHEBI:67545) has role metabolite (CHEBI:25212) |
| cochinchinoxanthone (CHEBI:67545) has role plant metabolite (CHEBI:76924) |
| cochinchinoxanthone (CHEBI:67545) is a cyclic ether (CHEBI:37407) |
| cochinchinoxanthone (CHEBI:67545) is a cyclic ketone (CHEBI:3992) |
| cochinchinoxanthone (CHEBI:67545) is a organic heteropentacyclic compound (CHEBI:38164) |
| cochinchinoxanthone (CHEBI:67545) is a phenols (CHEBI:33853) |
| cochinchinoxanthone (CHEBI:67545) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| (1S,3aR,5R,12aR)-8,10-dihydroxy-3,3-dimethyl-1-(3-methylbut-2-en-1-yl)-3,3a,4,5-tetrahydro-7H-1,5-methanofuro[3,4-d]xanthene-7,13-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559758 | Reaxys |
| Citations |
|---|