EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O5 |
| Net Charge | 0 |
| Average Mass | 406.478 |
| Monoisotopic Mass | 406.17802 |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(O)c(CC=C(C)C)c1 |
| InChI | InChI=1S/C25H26O5/c1-15(2)5-6-17-13-18(9-12-21(17)27)23-22(29-3)14-20(25(30-4)24(23)28)16-7-10-19(26)11-8-16/h5,7-14,26-28H,6H2,1-4H3 |
| InChIKey | YEVBMDOXFLFVJJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus taichungensis (ncbitaxon:482145) | mycelium (BTO:0001436) | PubMed (21486068) | EtOAc extract of fungal strain was isolated from root soil of Acrostichum aureum (mangrove plant) Strain: ZHN 7-07 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenylterphenyllin (CHEBI:67533) has role Aspergillus metabolite (CHEBI:76956) |
| prenylterphenyllin (CHEBI:67533) has role antineoplastic agent (CHEBI:35610) |
| prenylterphenyllin (CHEBI:67533) is a para-terphenyl (CHEBI:75874) |
| prenylterphenyllin (CHEBI:67533) is a dimethoxybenzene (CHEBI:51681) |
| prenylterphenyllin (CHEBI:67533) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3',6'-dimethoxy-3-(3-methylbut-2-en-1-yl)-1,1':4',1''-terphenyl-2',4,4''-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21577511 | Reaxys |
| Citations |
|---|