EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H72N2O12S |
| Net Charge | 0 |
| Average Mass | 901.173 |
| Monoisotopic Mass | 900.48060 |
| SMILES | CNC(=O)O[C@@H](CC(C)C)c1nc([C@H]2OC(=O)/C(C)=C/C/C(C)=C/[C@@H](O)[C@@H](C)/C=C(C)\C=C(C)/C=C/[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](C)[C@H](OC)/C(C)=C/C=C/[C@@H]2C)cs1 |
| InChI | InChI=1S/C48H72N2O12S/c1-26(2)20-38(61-48(57)49-11)45-50-35(25-63-45)44-31(7)15-13-14-30(6)43(58-12)34(10)37(59-47-42(55)41(54)40(53)39(24-51)60-47)19-17-27(3)21-29(5)22-33(9)36(52)23-28(4)16-18-32(8)46(56)62-44/h13-15,17-19,21-23,25-26,31,33-34,36-44,47,51-55H,16,20,24H2,1-12H3,(H,49,57)/b15-13+,19-17+,27-21-,28-23+,29-22-,30-14+,32-18+/t31-,33-,34-,36+,37+,38-,39+,40+,41-,42+,43+,44-,47+/m0/s1 |
| InChIKey | JOMXBNJRLRZHRP-OUEDXNQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter violaceus (ncbitaxon:83451) | latex (BTO:0000710) | PubMed (21513292) | Previous component: resin; Mixture of wet cell mass and adsorber resin was extracted with acetone Strain: Cb vi105 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| archazolid E (CHEBI:67524) has role metabolite (CHEBI:25212) |
| archazolid E (CHEBI:67524) is a macrolide (CHEBI:25106) |
| Synonym | Source |
|---|---|
| archazolid A-15-O-beta-D-glucopyranoside | ChEBI |
| Citations |
|---|