EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N4O6 |
| Net Charge | 0 |
| Average Mass | 556.704 |
| Monoisotopic Mass | 556.32609 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](C(C)C)NC(=O)C[C@H](/C=C/c2ccccc2)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C30H44N4O6/c1-8-19(6)26-29(38)33-25(18(4)5)30(39)40-22(15-14-21-12-10-9-11-13-21)16-23(35)32-24(17(2)3)28(37)31-20(7)27(36)34-26/h9-15,17-20,22,24-26H,8,16H2,1-7H3,(H,31,37)(H,32,35)(H,33,38)(H,34,36)/b15-14+/t19-,20+,22-,24-,25-,26-/m0/s1 |
| InChIKey | SMWGFJCKWZCJNQ-VTKBYMJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus species RJA2194 (ncbitaxon:1037354) | - | PubMed (21539394) | Methanolic extract of lyophilized solid agar and cells |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Turnagainolide A (CHEBI:67522) has role metabolite (CHEBI:25212) |
| Turnagainolide A (CHEBI:67522) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|