EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44O8 |
| Net Charge | 0 |
| Average Mass | 628.762 |
| Monoisotopic Mass | 628.30362 |
| SMILES | [H][C@@]12C[C@@]3([H])C=C4C(=O)c5c(O)c6c(c(CC=C(C)C)c5O[C@]41[C@@](C/C=C(/C)C(=O)O)(OC2(C)C)C3=O)O[C@](C)(CCC=C(C)C)C=C6 |
| InChI | InChI=1S/C38H44O8/c1-20(2)10-9-15-36(8)16-14-24-29(39)28-30(40)26-18-23-19-27-35(6,7)46-37(33(23)41,17-13-22(5)34(42)43)38(26,27)45-32(28)25(31(24)44-36)12-11-21(3)4/h10-11,13-14,16,18,23,27,39H,9,12,15,17,19H2,1-8H3,(H,42,43)/b22-13-/t23-,27+,36-,37+,38-/m1/s1 |
| InChIKey | GEZHEQNLKAOMCA-RRZNCOCZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia hanburyi (ncbitaxon:231906) | - | PubMed (21486005) | Extract of gamboge,a resin exudate from plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-gambogic acid (CHEBI:67521) has role metabolite (CHEBI:25212) |
| (-)-gambogic acid (CHEBI:67521) is a pyranoxanthones (CHEBI:71238) |
| Synonyms | Source |
|---|---|
| (2Z)-4-[(1S,2S,8R,17S,19R)-12-Hydroxy-8,21,21-trimethyl-5-(3-methyl-2-buten-1-yl)-8-(4-methyl-3-penten-1-yl)-14,18-dioxo-3,7,20-trioxahexacyclo[15.4.1.0[2,15].0[2,19].0[4,13].0[6,11]]docosa-4(13),5,9, 11,15-pentaen-19-yl]-2-methyl-2-butenoic acid | ChEBI |
| beta-Guttiferin | ChEBI |
| Guttic acid | ChEBI |
| Citations |
|---|