EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O2 |
| Net Charge | 0 |
| Average Mass | 310.397 |
| Monoisotopic Mass | 310.16813 |
| SMILES | [H][C@@]12C[C@@]34Nc5ccccc5[C@]3(C=C1CO)CC[N+]4([O-])C/C2=C/C |
| InChI | InChI=1S/C19H22N2O2/c1-2-13-11-21(23)8-7-18-9-14(12-22)15(13)10-19(18,21)20-17-6-4-3-5-16(17)18/h2-6,9,15,20,22H,7-8,10-12H2,1H3/b13-2-/t15-,18+,19-,21?/m0/s1 |
| InChIKey | JAEYVIULIFERFK-DUWYZNKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gardneria ovata (ncbitaxon:84944) | aerial part (BTO:0001658) | PubMed (21425787) | 90% methanolic extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Minfiensine-N(4)-oxide (CHEBI:67514) has role metabolite (CHEBI:25212) |
| Minfiensine-N(4)-oxide (CHEBI:67514) is a carbazoles (CHEBI:48513) |
| Minfiensine-N(4)-oxide (CHEBI:67514) is a tertiary amine oxide (CHEBI:134363) |
| Synonym | Source |
|---|---|
| [(1R,9S,11S,12E)-12-Ethylidene-14-oxido-8,14-diazapentacyclo[9.5.2.0[1,9].0[2,7].0[9,14]]octadeca-2,4,6,17-tetraen-18-yl]methanol | ChEBI |
| Citations |
|---|