EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N3 |
| Net Charge | 0 |
| Average Mass | 223.279 |
| Monoisotopic Mass | 223.11095 |
| SMILES | CC#Cc1cc(C)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H13N3/c1-3-7-13-10-11(2)15-14(17-13)16-12-8-5-4-6-9-12/h4-6,8-10H,1-2H3,(H,15,16,17) |
| InChIKey | CIFWZNRJIBNXRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepanipyrim (CHEBI:6751) has role antifungal agrochemical (CHEBI:86328) |
| mepanipyrim (CHEBI:6751) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| mepanipyrim (CHEBI:6751) has role hepatotoxic agent (CHEBI:50908) |
| mepanipyrim (CHEBI:6751) is a acetylenic compound (CHEBI:73474) |
| mepanipyrim (CHEBI:6751) is a aminopyrimidine (CHEBI:38338) |
| mepanipyrim (CHEBI:6751) is a anilinopyrimidine fungicide (CHEBI:87208) |
| mepanipyrim (CHEBI:6751) is a secondary amino compound (CHEBI:50995) |
| Synonyms | Source |
|---|---|
| 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine | Alan Wood's Pesticides |
| 4-Methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine | ChemIDplus |
| N-(4-methyl-6-prop-1-ynylpyrimidin-2-yl)aniline | Alan Wood's Pesticides |
| N-(4-Methyl-6-prop-1-ynylpyrimidin-2-yl)aniline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 435 | PPDB |
| C10919 | KEGG COMPOUND |
| mepanipyrim | Alan Wood's Pesticides |
| NZ548020 | Patent |
| WO2012011287 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8392999 | Reaxys |
| CAS:110235-47-7 | KEGG COMPOUND |
| CAS:110235-47-7 | NIST Chemistry WebBook |
| CAS:110235-47-7 | ChemIDplus |
| Citations |
|---|