EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O12 |
| Net Charge | 0 |
| Average Mass | 482.438 |
| Monoisotopic Mass | 482.14243 |
| SMILES | COc1cc(C(=O)OC[C@H]2O[C@@H](Oc3cc(O)c(OC)c(OC)c3)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C22H26O12/c1-29-14-6-10(4-5-12(14)23)21(28)32-9-16-17(25)18(26)19(27)22(34-16)33-11-7-13(24)20(31-3)15(8-11)30-2/h4-8,16-19,22-27H,9H2,1-3H3/t16-,17-,18+,19-,22-/m1/s1 |
| InChIKey | WCXHEUMNHRAWIJ-NFSXTHTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gordonia chrysandra (ncbitaxon:182314) | stem (BTO:0001300) | PubMed (21473609) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role anti-inflammatory agent (CHEBI:67079) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role metabolite (CHEBI:25212) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role plant metabolite (CHEBI:76924) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a benzoate ester (CHEBI:36054) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a dimethoxybenzene (CHEBI:51681) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a monosaccharide derivative (CHEBI:63367) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a phenols (CHEBI:33853) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-4,5-dimethoxyphenyl 6-O-(4-hydroxy-3-methoxybenzoyl)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534289 | Reaxys |
| Citations |
|---|