EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O12 |
| Net Charge | 0 |
| Average Mass | 482.438 |
| Monoisotopic Mass | 482.14243 |
| SMILES | COc1cc(C(=O)OC[C@H]2O[C@@H](Oc3cc(O)c(OC)c(OC)c3)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C22H26O12/c1-29-14-6-10(4-5-12(14)23)21(28)32-9-16-17(25)18(26)19(27)22(34-16)33-11-7-13(24)20(31-3)15(8-11)30-2/h4-8,16-19,22-27H,9H2,1-3H3/t16-,17-,18+,19-,22-/m1/s1 |
| InChIKey | WCXHEUMNHRAWIJ-NFSXTHTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gordonia chrysandra (ncbitaxon:182314) | stem (BTO:0001300) | PubMed (21473609) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role anti-inflammatory agent (CHEBI:67079) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role metabolite (CHEBI:25212) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) has role plant metabolite (CHEBI:76924) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a benzoate ester (CHEBI:36054) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a dimethoxybenzene (CHEBI:51681) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a monosaccharide derivative (CHEBI:63367) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a phenols (CHEBI:33853) |
| 1-O-3,4-dimethoxy-5-hydroxyphenyl-(6-O-vanilloyl)-β-D-glucopyranoside (CHEBI:67506) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-4,5-dimethoxyphenyl 6-O-(4-hydroxy-3-methoxybenzoyl)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534289 | Reaxys |
| Citations |
|---|