EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | COc1cc(OC)c2c(c1)O/C(=C\c1ccc(OC)c(O)c1)C2=O |
| InChI | InChI=1S/C18H16O6/c1-21-11-8-14(23-3)17-15(9-11)24-16(18(17)20)7-10-4-5-13(22-2)12(19)6-10/h4-9,19H,1-3H3/b16-7- |
| InChIKey | YUECETOWCFGWQI-APSNUPSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-hydroxy-4,6,4'-trimethoxyaurone (CHEBI:67496) has functional parent aurone (CHEBI:47964) |
| 3'-hydroxy-4,6,4'-trimethoxyaurone (CHEBI:67496) has role plant metabolite (CHEBI:76924) |
| 3'-hydroxy-4,6,4'-trimethoxyaurone (CHEBI:67496) is a hydroxyaurone (CHEBI:85970) |
| 3'-hydroxy-4,6,4'-trimethoxyaurone (CHEBI:67496) is a methoxyaurone (CHEBI:85967) |
| IUPAC Name |
|---|
| (2Z)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:43306 | Reaxys |
| Citations |
|---|