EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1CC(c2cc(O)cc(O)c2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O6/c16-8-1-7(2-9(17)3-8)13-6-12(20)15-11(19)4-10(18)5-14(15)21-13/h1-5,13,16-19H,6H2 |
| InChIKey | AYHOUUNTAVCXBN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7,3',5'-tetrahydroxyflavanone (CHEBI:67494) has functional parent flavanone (CHEBI:5070) |
| 5,7,3',5'-tetrahydroxyflavanone (CHEBI:67494) has role plant metabolite (CHEBI:76924) |
| 5,7,3',5'-tetrahydroxyflavanone (CHEBI:67494) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| 2-(3,5-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7489507 | Reaxys |
| Citations |
|---|