EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(OC)c(O)c3)oc2c1 |
| InChI | InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-12(23-2)10(18)5-8/h3-7,18-19,21H,1-2H3 |
| InChIKey | BWORNNDZQGOKBY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ombuin (CHEBI:67493) has functional parent quercetin (CHEBI:16243) |
| ombuin (CHEBI:67493) has role anti-inflammatory agent (CHEBI:67079) |
| ombuin (CHEBI:67493) has role plant metabolite (CHEBI:76924) |
| ombuin (CHEBI:67493) is a dimethoxyflavone (CHEBI:23798) |
| ombuin (CHEBI:67493) is a flavonols (CHEBI:28802) |
| ombuin (CHEBI:67493) is a trihydroxyflavone (CHEBI:27116) |
| ombuin (CHEBI:67493) is conjugate acid of 7,4'-O-dimethylquercetin 3-olate (CHEBI:194068) |
| Incoming Relation(s) |
| ombuoside (CHEBI:234346) has functional parent ombuin (CHEBI:67493) |
| 7,4'-O-dimethylquercetin 3-olate (CHEBI:194068) is conjugate base of ombuin (CHEBI:67493) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',7-dimethoxy-3,3',5-trihydroxyflavone | ChemIDplus |
| 7,4'-di-O-methylquercetin | ChEBI |
| 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMPK12112652 | LIPID MAPS |
| Ombuin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:338215 | Reaxys |
| CAS:529-40-8 | ChemIDplus |
| Citations |
|---|