EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67492 - tamarixetin
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O |
| InChI | InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
| InChIKey | FPLMIPQZHHQWHN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamarixetin (CHEBI:67492) has functional parent quercetin (CHEBI:16243) |
| tamarixetin (CHEBI:67492) has role antioxidant (CHEBI:22586) |
| tamarixetin (CHEBI:67492) has role metabolite (CHEBI:25212) |
| tamarixetin (CHEBI:67492) is a 7-hydroxyflavonol (CHEBI:52267) |
| tamarixetin (CHEBI:67492) is a monomethoxyflavone (CHEBI:25401) |
| tamarixetin (CHEBI:67492) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Quercetin 4'-methyl ether | KEGG COMPOUND |
| 4'-Methoxyquercetin | ChemIDplus |
| 4'-Methoxy-3,3',5,7-tetrahydroxyflavone | ChemIDplus |
| 3,5,7-Trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| Citations |
|---|