EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(C)=O |
| InChI | InChI=1S/C14H18O4/c1-8(2)5-6-10-11(16)7-12(18-4)13(9(3)15)14(10)17/h5,7,16-17H,6H2,1-4H3 |
| InChIKey | KASLWEHUDINBOP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Preremirol (CHEBI:67490) has functional parent phloroglucinol (CHEBI:16204) |
| Preremirol (CHEBI:67490) has role metabolite (CHEBI:25212) |
| Preremirol (CHEBI:67490) is a carboxylic ester (CHEBI:33308) |
| Synonym | Source |
|---|---|
| 1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]ethanone | ChEBI |
| Citations |
|---|