EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O5 |
| Net Charge | 0 |
| Average Mass | 290.315 |
| Monoisotopic Mass | 290.11542 |
| SMILES | C=C(C)[C@@H]1Cc2c(c(OC)c3oc(C)c(O)c3c2OC)O1 |
| InChI | InChI=1S/C16H18O5/c1-7(2)10-6-9-13(18-4)11-12(17)8(3)20-15(11)16(19-5)14(9)21-10/h10,17H,1,6H2,2-5H3/t10-/m0/s1 |
| InChIKey | RHTKCQDFRWJEIX-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2S-Isopropenyl-4,8-dimethoxy-5-hydroxy-6-methyl-2,3-dihydrobenzo[1,2-b:5,4-b']difuran (CHEBI:67489) has role metabolite (CHEBI:25212) |
| 2S-Isopropenyl-4,8-dimethoxy-5-hydroxy-6-methyl-2,3-dihydrobenzo[1,2-b:5,4-b']difuran (CHEBI:67489) is a benzofurans (CHEBI:35259) |
| Citations |
|---|