EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O4 |
| Net Charge | 0 |
| Average Mass | 498.748 |
| Monoisotopic Mass | 498.37091 |
| SMILES | [H][C@@]1(C(=C)C)CCC(=C)[C@H](CC[C@H]2C(C)=CC[C@@H](C(=C)C)[C@]2(C)CCC(=O)O)[C@@]1(C)CCC(=O)OCC |
| InChI | InChI=1S/C32H50O4/c1-10-36-30(35)18-20-32(9)26(22(4)5)14-12-24(7)28(32)16-15-27-23(6)11-13-25(21(2)3)31(27,8)19-17-29(33)34/h11,25-28H,2,4,7,10,12-20H2,1,3,5-6,8-9H3,(H,33,34)/t25-,26-,27-,28-,31-,32-/m0/s1 |
| InChIKey | ZLSDLEGKMGQSFU-BFIHGEENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lansic acid 3-ethyl ester (CHEBI:67480) has functional parent lansic acid (CHEBI:67482) |
| lansic acid 3-ethyl ester (CHEBI:67480) has role antibacterial agent (CHEBI:33282) |
| lansic acid 3-ethyl ester (CHEBI:67480) has role plant metabolite (CHEBI:76924) |
| lansic acid 3-ethyl ester (CHEBI:67480) is a dicarboxylic acid monoester (CHEBI:36244) |
| lansic acid 3-ethyl ester (CHEBI:67480) is a ethyl ester (CHEBI:23990) |
| lansic acid 3-ethyl ester (CHEBI:67480) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| 3-[(1S,2S,6S)-2-{2-[(1S,2S,3S)-2-(3-ethoxy-3-oxopropyl)-2-methyl-6-methylidene-3-(prop-1-en-2-yl)cyclohexyl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534277 | Reaxys |
| Citations |
|---|