EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@@]12CC=C(C)[C@H](CC/C=C(\C)CC/C=C(\C)CC[C@@H](O)C(C)(C)O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H50O3/c1-21(11-9-12-22(2)15-18-27(32)29(6,7)33)13-10-14-24-23(3)16-17-25-28(4,5)26(31)19-20-30(24,25)8/h12-13,16,24-25,27,32-33H,9-11,14-15,17-20H2,1-8H3/b21-13+,22-12+/t24-,25-,27+,30+/m0/s1 |
| InChIKey | RYDUWPYFQUMUJP-JAKYJIPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin F (CHEBI:67479) has role antibacterial agent (CHEBI:33282) |
| lamesticumin F (CHEBI:67479) has role metabolite (CHEBI:25212) |
| lamesticumin F (CHEBI:67479) has role plant metabolite (CHEBI:76924) |
| lamesticumin F (CHEBI:67479) is a cyclic terpene ketone (CHEBI:36130) |
| lamesticumin F (CHEBI:67479) is a diol (CHEBI:23824) |
| lamesticumin F (CHEBI:67479) is a hexahydronaphthalenes (CHEBI:142348) |
| lamesticumin F (CHEBI:67479) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (4aR,5S,8aR)-5-[(3E,7E,11R)-11,12-dihydroxy-4,8,12-trimethyltrideca-3,7-dien-1-yl]-1,1,4a,6-tetramethyl-3,4,4a,5,8,8a-hexahydronaphthalen-2(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534276 | Reaxys |
| Citations |
|---|