EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O4 |
| Net Charge | 0 |
| Average Mass | 484.721 |
| Monoisotopic Mass | 484.35526 |
| SMILES | [H][C@@]1(C(=C)C)C[C@@H](O)C(C)=C(CC[C@H]2C(=C)CC[C@@]3([H])C(C)(C)C(=O)CC[C@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H48O4/c1-19(2)24-18-25(32)21(4)23(30(24,7)17-15-28(34)35-9)12-11-22-20(3)10-13-26-29(5,6)27(33)14-16-31(22,26)8/h22,24-26,32H,1,3,10-18H2,2,4-9H3/t22-,24-,25+,26-,30+,31+/m0/s1 |
| InChIKey | JDTRJLXTQXQSSV-FJWCHDPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin E (CHEBI:67478) has role antibacterial agent (CHEBI:33282) |
| lamesticumin E (CHEBI:67478) has role plant metabolite (CHEBI:76924) |
| lamesticumin E (CHEBI:67478) is a cyclic terpene ketone (CHEBI:36130) |
| lamesticumin E (CHEBI:67478) is a methyl ester (CHEBI:25248) |
| lamesticumin E (CHEBI:67478) is a secondary alcohol (CHEBI:35681) |
| lamesticumin E (CHEBI:67478) is a triterpenoid (CHEBI:36615) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534281 | Reaxys |
| Citations |
|---|