EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@@]12C[C@@H](O)C(C)=C(CC[C@H]3C(=C)CC[C@@]4([H])C(C)(C)C(=O)CC[C@]34C)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H46O3/c1-18-9-12-23-27(3,4)25(32)13-15-29(23,7)20(18)10-11-21-19(2)22(31)17-24-28(5,6)26(33)14-16-30(21,24)8/h20,22-24,31H,1,9-17H2,2-8H3/t20-,22+,23-,24-,29+,30+/m0/s1 |
| InChIKey | MGVFDWIGIYHFIO-CKQYGLACSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin D (CHEBI:67477) has role antibacterial agent (CHEBI:33282) |
| lamesticumin D (CHEBI:67477) has role metabolite (CHEBI:25212) |
| lamesticumin D (CHEBI:67477) has role plant metabolite (CHEBI:76924) |
| lamesticumin D (CHEBI:67477) is a cyclic terpene ketone (CHEBI:36130) |
| lamesticumin D (CHEBI:67477) is a octahydronaphthalenes (CHEBI:138397) |
| lamesticumin D (CHEBI:67477) is a secondary alcohol (CHEBI:35681) |
| lamesticumin D (CHEBI:67477) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (4aS,7R,8aR)-7-hydroxy-1,1,4a,6-tetramethyl-5-{2-[(1S,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-6-oxodecahydronaphthalen-1-yl]ethyl}-3,4,4a,7,8,8a-hexahydronaphthalen-2(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534279 | Reaxys |
| Citations |
|---|