EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@@]12CC(=O)C(C)=C(CC[C@H]3C(=C)CC[C@@]4([H])C(C)(C)[C@@H](O)CC[C@]34C)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H46O3/c1-18-9-12-23-27(3,4)25(32)13-15-29(23,7)20(18)10-11-21-19(2)22(31)17-24-28(5,6)26(33)14-16-30(21,24)8/h20,23-25,32H,1,9-17H2,2-8H3/t20-,23-,24-,25-,29+,30+/m0/s1 |
| InChIKey | DJHULNDUQFBXME-DVMOUVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin C (CHEBI:67476) has role antibacterial agent (CHEBI:33282) |
| lamesticumin C (CHEBI:67476) has role plant metabolite (CHEBI:76924) |
| lamesticumin C (CHEBI:67476) is a cyclic terpene ketone (CHEBI:36130) |
| lamesticumin C (CHEBI:67476) is a octahydronaphthalenes (CHEBI:138397) |
| lamesticumin C (CHEBI:67476) is a secondary alcohol (CHEBI:35681) |
| lamesticumin C (CHEBI:67476) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (4aS,8aR)-5-{2-[(1S,4aR,6S,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethyl}-1,1,4a,6-tetramethyl-4,4a,8,8a-tetrahydronaphthalene-2,7(1H,3H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534278 | Reaxys |
| Citations |
|---|