EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O4 |
| Net Charge | 0 |
| Average Mass | 488.753 |
| Monoisotopic Mass | 488.38656 |
| SMILES | [H][C@@]1(C(C)(C)O)CC=C(C)[C@H](CC[C@H]2C(=C)CC[C@@]3([H])C(C)(C)[C@@H](O)CC[C@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H52O4/c1-20-10-14-24-28(3,4)26(32)16-18-30(24,7)22(20)12-13-23-21(2)11-15-25(29(5,6)34)31(23,8)19-17-27(33)35-9/h11,22-26,32,34H,1,10,12-19H2,2-9H3/t22-,23-,24-,25-,26-,30+,31+/m0/s1 |
| InChIKey | KYHATJJXUGJUJJ-LUFVGXTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin B (CHEBI:67475) has role antibacterial agent (CHEBI:33282) |
| lamesticumin B (CHEBI:67475) has role plant metabolite (CHEBI:76924) |
| lamesticumin B (CHEBI:67475) is a diol (CHEBI:23824) |
| lamesticumin B (CHEBI:67475) is a methyl ester (CHEBI:25248) |
| lamesticumin B (CHEBI:67475) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| rel-methyl 3-[(1R,2S,6R)-6-(2-hydroxypropan-2-yl)-2-{2-[(1S,4aR,6S,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethyl}-1,3-dimethylcyclohex-3-en-1-yl]propanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534280 | Reaxys |
| Citations |
|---|