EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O5 |
| Net Charge | 0 |
| Average Mass | 502.736 |
| Monoisotopic Mass | 502.36582 |
| SMILES | [H][C@]1(CC[C@H]2C(C)=CC[C@@]([H])(C(=C)C)[C@]2(C)CCC(=O)O)C(=C)CC[C@@]([H])(C(C)(C)O)[C@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H50O5/c1-20(2)23-12-10-21(3)24(30(23,7)18-16-27(32)33)13-14-25-22(4)11-15-26(29(5,6)35)31(25,8)19-17-28(34)36-9/h10,23-26,35H,1,4,11-19H2,2-3,5-9H3,(H,32,33)/t23-,24-,25-,26-,30-,31+/m0/s1 |
| InChIKey | WWMHSLBXALTJEY-YTASFOGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin A (CHEBI:67473) has role antibacterial agent (CHEBI:33282) |
| lamesticumin A (CHEBI:67473) has role metabolite (CHEBI:25212) |
| lamesticumin A (CHEBI:67473) has role plant metabolite (CHEBI:76924) |
| lamesticumin A (CHEBI:67473) is a dicarboxylic acid monoester (CHEBI:36244) |
| lamesticumin A (CHEBI:67473) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| lamesticumin A (CHEBI:67473) is a methyl ester (CHEBI:25248) |
| lamesticumin A (CHEBI:67473) is a tertiary alcohol (CHEBI:26878) |
| lamesticumin A (CHEBI:67473) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| rel-3-[(1S,2S,6S)-2-{2-[(1S,2R,3R)-3-(2-hydroxypropan-2-yl)-2-(3-methoxy-3-oxopropyl)-2-methyl-6-methylidenecyclohexyl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534282 | Reaxys |
| Citations |
|---|