EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O5 |
| Net Charge | 0 |
| Average Mass | 502.736 |
| Monoisotopic Mass | 502.36582 |
| SMILES | [H][C@]1(CC[C@H]2C(C)=CC[C@@]([H])(C(=C)C)[C@]2(C)CCC(=O)O)C(=C)CC[C@@]([H])(C(C)(C)O)[C@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H50O5/c1-20(2)23-12-10-21(3)24(30(23,7)18-16-27(32)33)13-14-25-22(4)11-15-26(29(5,6)35)31(25,8)19-17-28(34)36-9/h10,23-26,35H,1,4,11-19H2,2-3,5-9H3,(H,32,33)/t23-,24-,25-,26-,30-,31+/m0/s1 |
| InChIKey | WWMHSLBXALTJEY-YTASFOGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamesticumin A (CHEBI:67473) has role antibacterial agent (CHEBI:33282) |
| lamesticumin A (CHEBI:67473) has role metabolite (CHEBI:25212) |
| lamesticumin A (CHEBI:67473) has role plant metabolite (CHEBI:76924) |
| lamesticumin A (CHEBI:67473) is a dicarboxylic acid monoester (CHEBI:36244) |
| lamesticumin A (CHEBI:67473) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| lamesticumin A (CHEBI:67473) is a methyl ester (CHEBI:25248) |
| lamesticumin A (CHEBI:67473) is a tertiary alcohol (CHEBI:26878) |
| lamesticumin A (CHEBI:67473) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| rel-3-[(1S,2S,6S)-2-{2-[(1S,2R,3R)-3-(2-hydroxypropan-2-yl)-2-(3-methoxy-3-oxopropyl)-2-methyl-6-methylidenecyclohexyl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534282 | Reaxys |
| Citations |
|---|