EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O11 |
| Net Charge | 0 |
| Average Mass | 568.660 |
| Monoisotopic Mass | 568.28836 |
| SMILES | [H][C@]12CC(O)O[C@@]1([H])O[C@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])C[C@@H](O)[C@H](OC(=O)C(C)CC)[C@]31CO1)C2 |
| InChI | InChI=1S/C29H44O11/c1-7-14(2)25(34)40-24-19(32)11-20-27(6,21-9-18-10-23(33)39-26(18)38-21)15(3)8-22(37-17(5)31)28(20,12-35-16(4)30)29(24)13-36-29/h14-15,18-24,26,32-33H,7-13H2,1-6H3/t14?,15-,18+,19-,20-,21+,22+,23?,24+,26-,27+,28+,29-/m1/s1 |
| InChIKey | SAENNVULKVVZSO-ZDEAQARGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga bracteosa (IPNI:444535-1) | aerial part (BTO:0001658) | PubMed (21539300) | Crude dichloromethane extract of dried and powdered aerial parts, C-15 epimeric mixture |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) has role antifeedant (CHEBI:22583) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) has role plant metabolite (CHEBI:76924) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) is a acetate ester (CHEBI:47622) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) is a cyclic acetal (CHEBI:59770) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) is a diterpenoid (CHEBI:23849) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) is a furofuran (CHEBI:47790) |
| 14-hydro-15-hydroxyajugapitin (CHEBI:67471) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,2S,3R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-3-hydroxy-5-[(2S,3aS,6aR)-5-hydroxyhexahydrofuro[2,3-b]furan-2-yl]-5,6-dimethyloctahydro-2H-spiro[naphthalene-1,2'-oxiran]-2-yl 2-methylbutanoate |
| Synonym | Source |
|---|---|
| 14-hydro-2,15-dihydroxy-3β-isobutyryloxyclerodin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6552581 | Reaxys |
| Citations |
|---|