EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O7 |
| Net Charge | 0 |
| Average Mass | 436.545 |
| Monoisotopic Mass | 436.24610 |
| SMILES | [H][C@]12CCO[C@@]1([H])O[C@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@@]3(COC(C)=O)[C@]4(CCC[C@]13[H])CO4)C2 |
| InChI | InChI=1S/C24H36O7/c1-14-10-20(30-16(3)26)24(13-28-15(2)25)18(6-5-8-23(24)12-29-23)22(14,4)19-11-17-7-9-27-21(17)31-19/h14,17-21H,5-13H2,1-4H3/t14-,17-,18-,19+,20+,21+,22+,23+,24+/m1/s1 |
| InChIKey | GLFMZGODSSXZRK-NVSXQWMQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga bracteosa (IPNI:444535-1) | aerial part (BTO:0001658) | PubMed (21539300) | Crude dichloromethane extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14,15-dihydroclerodin (CHEBI:67464) has role antifeedant (CHEBI:22583) |
| 14,15-dihydroclerodin (CHEBI:67464) has role plant metabolite (CHEBI:76924) |
| 14,15-dihydroclerodin (CHEBI:67464) is a acetate ester (CHEBI:47622) |
| 14,15-dihydroclerodin (CHEBI:67464) is a cyclic acetal (CHEBI:59770) |
| 14,15-dihydroclerodin (CHEBI:67464) is a diterpenoid (CHEBI:23849) |
| 14,15-dihydroclerodin (CHEBI:67464) is a furofuran (CHEBI:47790) |
| 14,15-dihydroclerodin (CHEBI:67464) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| {(1R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-5-[(2S,3aR,6aS)-hexahydrofuro[2,3-b]furan-2-yl]-5,6-dimethyloctahydro-8aH-spiro[naphthalene-1,2'-oxiran]-8a-yl}methyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4588733 | Reaxys |
| Citations |
|---|