EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O9 |
| Net Charge | 0 |
| Average Mass | 492.565 |
| Monoisotopic Mass | 492.23593 |
| SMILES | [H][C@@]12OC=C[C@]1([H])C[C@@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])CC[C@H](OC(C)=O)[C@]31CO1)O2 |
| InChI | InChI=1S/C26H36O9/c1-14-10-22(34-17(4)29)25(12-31-15(2)27)19(6-7-20(33-16(3)28)26(25)13-32-26)24(14,5)21-11-18-8-9-30-23(18)35-21/h8-9,14,18-23H,6-7,10-13H2,1-5H3/t14-,18-,19-,20+,21+,22+,23+,24+,25+,26-/m1/s1 |
| InChIKey | QVORLEZTALRJNW-WBTQUOTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga bracteosa (IPNI:444535-1) | aerial part (BTO:0001658) | PubMed (21539300) | Crude dichloromethane extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epi-caryoptin (CHEBI:67462) has role plant metabolite (CHEBI:76924) |
| 3-epi-caryoptin (CHEBI:67462) is a acetate ester (CHEBI:47622) |
| 3-epi-caryoptin (CHEBI:67462) is a cyclic acetal (CHEBI:59770) |
| 3-epi-caryoptin (CHEBI:67462) is a diterpenoid (CHEBI:23849) |
| 3-epi-caryoptin (CHEBI:67462) is a furofuran (CHEBI:47790) |
| 3-epi-caryoptin (CHEBI:67462) is a spiro-epoxide (CHEBI:133131) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1444306 | Reaxys |
| CAS:53060-58-5 | ChemIDplus |
| Citations |
|---|