EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O9 |
| Net Charge | 0 |
| Average Mass | 536.662 |
| Monoisotopic Mass | 536.29853 |
| SMILES | [H][C@]12CCO[C@@]1([H])O[C@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])CC[C@H](OC(=O)C(C)CC)[C@]31CO1)C2 |
| InChI | InChI=1S/C29H44O9/c1-7-16(2)25(32)37-22-9-8-21-27(6,23-13-20-10-11-33-26(20)38-23)17(3)12-24(36-19(5)31)28(21,14-34-18(4)30)29(22)15-35-29/h16-17,20-24,26H,7-15H2,1-6H3/t16?,17-,20-,21-,22+,23+,24+,26+,27+,28+,29-/m1/s1 |
| InChIKey | KBXQQUMGZJQQJC-IOTHXJBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga bracteosa (IPNI:444535-1) | aerial part (BTO:0001658) | PubMed (21539300) | Crude dichloromethane extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajubractin C (CHEBI:67459) has role plant metabolite (CHEBI:76924) |
| ajubractin C (CHEBI:67459) is a acetate ester (CHEBI:47622) |
| ajubractin C (CHEBI:67459) is a cyclic acetal (CHEBI:59770) |
| ajubractin C (CHEBI:67459) is a diterpenoid (CHEBI:23849) |
| ajubractin C (CHEBI:67459) is a furofuran (CHEBI:47790) |
| ajubractin C (CHEBI:67459) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,2S,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-5-[(2S,3aR,6aS)-hexahydrofuro[2,3-b]furan-2-yl]-5,6-dimethyloctahydro-2H-spiro[naphthalene-1,2'-oxiran]-2-yl 2-methylbutanoate |
| Synonym | Source |
|---|---|
| 3β-(2-methyl)-butyryloxy-14,15-dihydroclerodin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534274 | Reaxys |
| Citations |
|---|