EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O9 |
| Net Charge | 0 |
| Average Mass | 520.619 |
| Monoisotopic Mass | 520.26723 |
| SMILES | [H][C@@]12OC=C[C@]1([H])C[C@@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])CC[C@H](OC(=O)C(C)C)[C@]31CO1)O2 |
| InChI | InChI=1S/C28H40O9/c1-15(2)24(31)36-21-8-7-20-26(6,22-12-19-9-10-32-25(19)37-22)16(3)11-23(35-18(5)30)27(20,13-33-17(4)29)28(21)14-34-28/h9-10,15-16,19-23,25H,7-8,11-14H2,1-6H3/t16-,19-,20-,21+,22+,23+,25+,26+,27+,28-/m1/s1 |
| InChIKey | RKCOYWMHQMBBIY-LIPLWNDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga bracteosa (IPNI:444535-1) | aerial part (BTO:0001658) | PubMed (21539300) | Crude dichloromethane extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajubractin B (CHEBI:67458) has role plant metabolite (CHEBI:76924) |
| ajubractin B (CHEBI:67458) is a acetate ester (CHEBI:47622) |
| ajubractin B (CHEBI:67458) is a cyclic acetal (CHEBI:59770) |
| ajubractin B (CHEBI:67458) is a diterpenoid (CHEBI:23849) |
| ajubractin B (CHEBI:67458) is a furofuran (CHEBI:47790) |
| ajubractin B (CHEBI:67458) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,2S,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-5,6-dimethyl-5-[(2S,3aS,6aS)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]octahydro-2H-spiro[naphthalene-1,2'-oxiran]-2-yl 2-methylpropanoate |
| Synonym | Source |
|---|---|
| 3β-(isobutyryloxy)clerodin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534271 | Reaxys |
| Citations |
|---|