EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O8 |
| Net Charge | 0 |
| Average Mass | 458.507 |
| Monoisotopic Mass | 458.19407 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)[C@H](OC(C)=O)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C25H30O8/c1-12-8-15-9-17(27-4)22(28-5)24(29-6)19(15)20-16(21(13(12)2)33-14(3)26)10-18-23(25(20)30-7)32-11-31-18/h9-10,12-13,21H,8,11H2,1-7H3/t12-,13-,21-/m1/s1 |
| InChIKey | QUGMSTJBNZWXQS-SQHYZVFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is R and S |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kadsurin, (-)- (CHEBI:67453) has role metabolite (CHEBI:25212) |
| Kadsurin, (-)- (CHEBI:67453) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| (6R,7R,8R)-1,2,3,13-Tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-8-yl acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:51670-40-7 | ChemIDplus |
| Citations |
|---|