EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O7 |
| Net Charge | 0 |
| Average Mass | 416.470 |
| Monoisotopic Mass | 416.18350 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)[C@H](O)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H28O7/c1-11-7-13-8-15(25-3)20(26-4)22(27-5)17(13)18-14(19(24)12(11)2)9-16-21(23(18)28-6)30-10-29-16/h8-9,11-12,19,24H,7,10H2,1-6H3/t11-,12-,19-/m1/s1 |
| InChIKey | YVMJUSKDPJGDHW-HNYWDRBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is S |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isogomisin O (CHEBI:67452) has role metabolite (CHEBI:25212) |
| Isogomisin O (CHEBI:67452) is a tannin (CHEBI:26848) |
| Citations |
|---|