EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O10 |
| Net Charge | 0 |
| Average Mass | 516.543 |
| Monoisotopic Mass | 516.19955 |
| SMILES | COc1c(OC)c2c(cc1OC)[C@H](OC(C)=O)[C@@H](C)[C@@H](C)[C@@H](OC(C)=O)c1cc3c(c(OC)c1-2)OCO3 |
| InChI | InChI=1S/C27H32O10/c1-12-13(2)23(37-15(4)29)17-10-19-25(35-11-34-19)27(33-8)21(17)20-16(22(12)36-14(3)28)9-18(30-5)24(31-6)26(20)32-7/h9-10,12-13,22-23H,11H2,1-8H3/t12-,13+,22+,23+/m0/s1 |
| InChIKey | JFBLYFBBLCKNMR-LPWDXZGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is S |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ananolignan F (CHEBI:67443) has role neuroprotective agent (CHEBI:63726) |
| ananolignan F (CHEBI:67443) has role plant metabolite (CHEBI:76924) |
| ananolignan F (CHEBI:67443) is a acetate ester (CHEBI:47622) |
| ananolignan F (CHEBI:67443) is a aromatic ether (CHEBI:35618) |
| ananolignan F (CHEBI:67443) is a lignan (CHEBI:25036) |
| ananolignan F (CHEBI:67443) is a organic heterotetracyclic compound (CHEBI:38163) |
| ananolignan F (CHEBI:67443) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (5R,6S,7R,8R)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxole-5,8-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534261 | Reaxys |
| Citations |
|---|