EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O9 |
| Net Charge | 0 |
| Average Mass | 472.490 |
| Monoisotopic Mass | 472.17333 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)[C@@H](OC(C)=O)[C@@H](C)[C@H](C)C2=O |
| InChI | InChI=1S/C25H28O9/c1-11-12(2)21(34-13(3)26)15-9-17-23(33-10-32-17)25(31-7)19(15)18-14(20(11)27)8-16(28-4)22(29-5)24(18)30-6/h8-9,11-12,21H,10H2,1-7H3/t11-,12-,21-/m0/s1 |
| InChIKey | AMQMJZAWJCIUQK-OABGYEMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is R |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ananolignan B (CHEBI:67439) has role metabolite (CHEBI:25212) |
| ananolignan B (CHEBI:67439) has role plant metabolite (CHEBI:76924) |
| ananolignan B (CHEBI:67439) is a acetate ester (CHEBI:47622) |
| ananolignan B (CHEBI:67439) is a aromatic ether (CHEBI:35618) |
| ananolignan B (CHEBI:67439) is a lignan (CHEBI:25036) |
| ananolignan B (CHEBI:67439) is a organic heterotetracyclic compound (CHEBI:38163) |
| ananolignan B (CHEBI:67439) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (6S,7S,8S)-1,2,3,13-tetramethoxy-6,7-dimethyl-5-oxo-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-8-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534258 | Reaxys |
| Citations |
|---|