EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O2 |
| Net Charge | 0 |
| Average Mass | 468.766 |
| Monoisotopic Mass | 468.39673 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CCC(=C)[C@@H](C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h21,23-27H,1,10-19H2,2-9H3/t21-,23-,24+,25-,26+,27-,29-,30+,31-,32-/m1/s1 |
| InChIKey | SFEUTIOWNUGQMZ-ZHLOSDGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taraxasterol acetate (CHEBI:67438) has role metabolite (CHEBI:25212) |
| taraxasterol acetate (CHEBI:67438) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| (3beta,18alpha,19alpha)-Urs-20(30)-en-3-yl acetate | ChEBI |
| Lactucon | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0006426433 | ChemIDplus |
| Citations |
|---|