EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | C/C=C(/C)C(=O)OCC(C)(OC)c1ccc(C)cc1O |
| InChI | InChI=1S/C16H22O4/c1-6-12(3)15(18)20-10-16(4,19-5)13-8-7-11(2)9-14(13)17/h6-9,17H,10H2,1-5H3/b12-6- |
| InChIKey | DLYGIKVZDGBGDN-SDQBBNPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-methoxy-9-O-angeloylthymol (CHEBI:67432) has role metabolite (CHEBI:25212) |
| 8-methoxy-9-O-angeloylthymol (CHEBI:67432) is a enoate ester (CHEBI:51702) |
| Synonym | Source |
|---|---|
| 2-(2-Hydroxy-4-methylphenyl)-2-methoxypropyl (2Z)-2-methyl-2-butenoate | ChEBI |
| Citations |
|---|