EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | COC(C)(COC(=O)C(C)C)c1ccc(C)cc1O |
| InChI | InChI=1S/C15H22O4/c1-10(2)14(17)19-9-15(4,18-5)12-7-6-11(3)8-13(12)16/h6-8,10,16H,9H2,1-5H3 |
| InChIKey | JUQOFHFHZAKXEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-methoxy-9-O-isobutyrylthymol (CHEBI:67431) has role metabolite (CHEBI:25212) |
| 8-methoxy-9-O-isobutyrylthymol (CHEBI:67431) is a benzyl ether (CHEBI:59859) |
| Synonym | Source |
|---|---|
| 2-(2-Hydroxy-4-methylphenyl)-2-methoxypropyl 2-methylpropanoate | ChEBI |
| Citations |
|---|