EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O4 |
| Net Charge | 0 |
| Average Mass | 288.343 |
| Monoisotopic Mass | 288.13616 |
| SMILES | C=C(COC(C)=O)c1ccc(C)cc1OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C17H20O4/c1-6-12(3)17(19)21-16-9-11(2)7-8-15(16)13(4)10-20-14(5)18/h6-9H,4,10H2,1-3,5H3/b12-6+ |
| InChIKey | YQTJNXJVGGXRFW-WUXMJOGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-acetoxy-8,10-dehydrothymol 3-O-tiglate (CHEBI:67427) has role metabolite (CHEBI:25212) |
| 9-acetoxy-8,10-dehydrothymol 3-O-tiglate (CHEBI:67427) is a benzoate ester (CHEBI:36054) |
| 9-acetoxy-8,10-dehydrothymol 3-O-tiglate (CHEBI:67427) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 2-(3-Acetoxy-1-propen-2-yl)-5-methylphenyl (2E)-2-methyl-2-butenoate | ChEBI |
| Citations |
|---|