EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | CC(=O)C(=O)c1ccc(C)cc1O |
| InChI | InChI=1S/C10H10O3/c1-6-3-4-8(9(12)5-6)10(13)7(2)11/h3-5,12H,1-2H3 |
| InChIKey | OXDKWKNIBKTRLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-hydroxy-4-methylphenyl)propan-1,2-dione (CHEBI:67425) has role metabolite (CHEBI:25212) |
| 1-(2-hydroxy-4-methylphenyl)propan-1,2-dione (CHEBI:67425) is a acetophenones (CHEBI:22187) |
| Citations |
|---|