EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1Oc2cc(C)ccc2[C@@]1(C)O |
| InChI | InChI=1S/C15H18O4/c1-5-10(3)13(16)19-14-15(4,17)11-7-6-9(2)8-12(11)18-14/h5-8,14,17H,1-4H3/b10-5-/t14-,15+/m0/s1 |
| InChIKey | QBRJXXZJFOHOGJ-KJUPGIGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eupatobenzofuran, (rel)- (CHEBI:67423) has role metabolite (CHEBI:25212) |
| Eupatobenzofuran, (rel)- (CHEBI:67423) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| rel-(Z)-[(2S,3R)-3-Hydroxy-3,6-dimethyl-2,3-dihydrobenzofuran-2-yl]2-methylbut-2-enoate | ChEBI |
| Citations |
|---|