EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | C=C(COC(=O)CC(C)C)c1ccc(C)cc1O |
| InChI | InChI=1S/C15H20O3/c1-10(2)7-15(17)18-9-12(4)13-6-5-11(3)8-14(13)16/h5-6,8,10,16H,4,7,9H2,1-3H3 |
| InChIKey | IYXKURCVMVQNOD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(3-methylbutanoyl)-8,10-dehydrothymol (CHEBI:67422) has role metabolite (CHEBI:25212) |
| 9-(3-methylbutanoyl)-8,10-dehydrothymol (CHEBI:67422) is a olefinic compound (CHEBI:78840) |
| Synonym | Source |
|---|---|
| 2-(2-hydroxy-4-methylphenyl)allyl 3-methylbutanoate | ChEBI |
| Citations |
|---|