EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H58O9 |
| Net Charge | 0 |
| Average Mass | 586.807 |
| Monoisotopic Mass | 586.40808 |
| SMILES | CCCCCCCCCCCCCCC[C@H](C[C@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@@H]1OC(=O)C=C[C@@H]1O)OC(C)=O |
| InChI | InChI=1S/C32H58O9/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-29(40-24(2)33)22-27(36)20-25(34)19-26(35)21-28(37)23-31-30(38)17-18-32(39)41-31/h17-18,25-31,34-38H,3-16,19-23H2,1-2H3/t25-,26+,27-,28+,29-,30+,31+/m1/s1 |
| InChIKey | QTODHKJVJUSIHI-YEWNYCFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya (ncbitaxon:22027) | - | PubMed (21539301) | CH2Cl2-MeOH(1:1) and 100% MeOH extract of dried and ground plant material |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptocaryol D (CHEBI:67419) has role metabolite (CHEBI:25212) |
| cryptocaryol D (CHEBI:67419) has role plant metabolite (CHEBI:76924) |
| cryptocaryol D (CHEBI:67419) is a 2-pyranones (CHEBI:75885) |
| cryptocaryol D (CHEBI:67419) is a acetate ester (CHEBI:47622) |
| cryptocaryol D (CHEBI:67419) is a pentol (CHEBI:37205) |
| IUPAC Name |
|---|
| (2S*,4S*,6R*,8R*,10R*)-2,4,6,8-tetrahydroxy-1-[(2S,3S)-3-hydroxy-6-oxo-3,6-dihydro-2H-pyran-2-yl]pentacosan-10-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548650 | Reaxys |
| Citations |
|---|