EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H56O8 |
| Net Charge | 0 |
| Average Mass | 544.770 |
| Monoisotopic Mass | 544.39752 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@@H]1OC(=O)C=C[C@@H]1O |
| InChI | InChI=1S/C30H56O8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-23(31)18-24(32)19-25(33)20-26(34)21-27(35)22-29-28(36)16-17-30(37)38-29/h16-17,23-29,31-36H,2-15,18-22H2,1H3/t23-,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | LCODPNNXGVNGAW-KVARLTFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya (ncbitaxon:22027) | - | PubMed (21539301) | CH2Cl2-MeOH(1:1) and 100% MeOH extract of dried and ground plant material |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptocaryol C (CHEBI:67418) has role metabolite (CHEBI:25212) |
| cryptocaryol C (CHEBI:67418) has role plant metabolite (CHEBI:76924) |
| cryptocaryol C (CHEBI:67418) is a 2-pyranones (CHEBI:75885) |
| cryptocaryol C (CHEBI:67418) is a hexol (CHEBI:37206) |
| IUPAC Name |
|---|
| (5S,6S)-5-hydroxy-6-[(2S*,4S*,6S*,8S*,10R*)-2,4,6,8,10-pentahydroxypentacosyl]-5,6-dihydro-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548648 | Reaxys |
| Citations |
|---|