EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H58O8 |
| Net Charge | 0 |
| Average Mass | 570.808 |
| Monoisotopic Mass | 570.41317 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](C[C@@H](O)C[C@@H](O)C[C@@H](O)C[C@@H](O)C[C@H]1CC=CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C32H58O8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-30(39-25(2)33)23-28(36)21-26(34)20-27(35)22-29(37)24-31-18-16-19-32(38)40-31/h16,19,26-31,34-37H,3-15,17-18,20-24H2,1-2H3/t26-,27+,28-,29+,30-,31+/m0/s1 |
| InChIKey | JUDSGWKIMNPKNH-XSFYONRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya (ncbitaxon:22027) | - | PubMed (21539301) | CH2Cl2-MeOH(1:1) and 100% MeOH extract of dried and ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptocaryol B (CHEBI:67417) has role plant metabolite (CHEBI:76924) |
| cryptocaryol B (CHEBI:67417) is a 2-pyranones (CHEBI:75885) |
| cryptocaryol B (CHEBI:67417) is a acetate ester (CHEBI:47622) |
| cryptocaryol B (CHEBI:67417) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (2R,4R,6S,8S,10S)-2,4,6,8-tetrahydroxy-1-[(2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl]pentacosan-10-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23730162 | Reaxys |
| Citations |
|---|