EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H56O7 |
| Net Charge | 0 |
| Average Mass | 528.771 |
| Monoisotopic Mass | 528.40260 |
| SMILES | CCCCCCCCCCCCCCC[C@H](O)C[C@@H](O)C[C@@H](O)C[C@@H](O)C[C@@H](O)C[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C30H56O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-24(31)19-25(32)20-26(33)21-27(34)22-28(35)23-29-17-15-18-30(36)37-29/h15,18,24-29,31-35H,2-14,16-17,19-23H2,1H3/t24-,25+,26+,27+,28+,29+/m0/s1 |
| InChIKey | GHNAMLOEGLSFMB-ZHMMVFJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya (ncbitaxon:22027) | - | PubMed (21539301) | CH2Cl2-MeOH(1:1) and 100% MeOH extract of dried and ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptocaryol A (CHEBI:67416) has role plant metabolite (CHEBI:76924) |
| cryptocaryol A (CHEBI:67416) is a 2-pyranones (CHEBI:75885) |
| cryptocaryol A (CHEBI:67416) is a pentol (CHEBI:37205) |
| IUPAC Name |
|---|
| (6R)-6-[(2R,4R,6R,8R,10S)-2,4,6,8,10-pentahydroxypentacosyl]-5,6-dihydro-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23730158 | Reaxys |
| Citations |
|---|