EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | OCc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2/c8-5-6-1-3-7(9)4-2-6/h1-4,8-9H,5H2 |
| InChIKey | BVJSUAQZOZWCKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-hydroxybenzyl alcohol (CHEBI:67410) has role plant metabolite (CHEBI:76924) |
| p-hydroxybenzyl alcohol (CHEBI:67410) is a benzyl alcohols (CHEBI:22743) |
| p-hydroxybenzyl alcohol (CHEBI:67410) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)phenol |
| Synonyms | Source |
|---|---|
| 4-hydroxybenzyl alcohol | ChEBI |
| p-Methylolphenol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-hydroxybenzyl alcohol | UniProt |
| Citations |
|---|