EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | COc1cc2c(cc1O)C(=O)N(C)CC2 |
| InChI | InChI=1S/C11H13NO3/c1-12-4-3-7-5-10(15-2)9(13)6-8(7)11(12)14/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | WPKMGEQXTYQXGI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thalifolin (CHEBI:67409) has role metabolite (CHEBI:25212) |
| thalifolin (CHEBI:67409) is a hydroxyquinoline (CHEBI:38774) |
| thalifolin (CHEBI:67409) is a quinolone (CHEBI:23765) |
| Synonym | Source |
|---|---|
| 7-Hydroxy-6-methoxy-2-methyl-3,4-dihydroisoquinolin-1-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21796-15-6 | ChemIDplus |
| Citations |
|---|