EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O11 |
| Net Charge | 0 |
| Average Mass | 518.600 |
| Monoisotopic Mass | 518.27271 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](O[C@H](C)CC[C@@]3([H])C(C)=CC(=O)CC3(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H42O11/c1-11-8-14(27)9-25(4,5)15(11)7-6-12(2)33-24-22(20(31)18(29)16(10-26)35-24)36-23-21(32)19(30)17(28)13(3)34-23/h8,12-13,15-24,26,28-32H,6-7,9-10H2,1-5H3/t12-,13+,15+,16-,17+,18-,19-,20+,21-,22-,23+,24-/m1/s1 |
| InChIKey | ZUTSCUCRFVUYIA-JLMNZIKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gusanlungionoside D (CHEBI:67407) has role metabolite (CHEBI:25212) |
| Gusanlungionoside D (CHEBI:67407) is a O-acyl carbohydrate (CHEBI:52782) |
| Synonym | Source |
|---|---|
| (6R,9R)-9-hydroxymegastigman-4-en-3-one 9-O-alpha-L-rhamnopyranosyl-(1''->2')-beta-D-glucopyranoside | ChEBI |
| Citations |
|---|