EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O6 |
| Net Charge | 0 |
| Average Mass | 330.336 |
| Monoisotopic Mass | 330.11034 |
| SMILES | C=C[C@@H](c1ccc(OC)c(O)c1)c1cc(O)c(C(=O)OC)cc1O |
| InChI | InChI=1S/C18H18O6/c1-4-11(10-5-6-17(23-2)16(21)7-10)12-8-15(20)13(9-14(12)19)18(22)24-3/h4-9,11,19-21H,1H2,2-3H3/t11-/m0/s1 |
| InChIKey | OROYBJUZDRBHII-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus santalinus (ncbitaxon:1071199) | heartwood (PO:0004512) | PubMed (21488654) | Dichloromethane soluble portion of MeOH extract of powdered heartwood |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pterolinus F (CHEBI:67388) has role metabolite (CHEBI:25212) |
| pterolinus F (CHEBI:67388) has role plant metabolite (CHEBI:76924) |
| pterolinus F (CHEBI:67388) is a aromatic ether (CHEBI:35618) |
| pterolinus F (CHEBI:67388) is a benzoate ester (CHEBI:36054) |
| pterolinus F (CHEBI:67388) is a hydroquinones (CHEBI:24646) |
| IUPAC Name |
|---|
| methyl 2,5-dihydroxy-4-[(1S)-1-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-yl]benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548612 | Reaxys |
| Citations |
|---|