EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1ccc([C@H]2Oc3cc(OC)c(O)cc3[C@@H]2C)cc1O |
| InChI | InChI=1S/C17H18O5/c1-9-11-7-13(19)16(21-3)8-15(11)22-17(9)10-4-5-14(20-2)12(18)6-10/h4-9,17-19H,1-3H3/t9-,17-/m0/s1 |
| InChIKey | AHLYGBUCWDHKBC-XYZCENFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus santalinus (ncbitaxon:1071199) | heartwood (PO:0004512) | PubMed (21488654) | Dichloromethane soluble portion of MeOH extract of powdered heartwood |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Melanoxin, (-)- (CHEBI:67387) has role metabolite (CHEBI:25212) |
| Melanoxin, (-)- (CHEBI:67387) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| (2S,3S)-2-(3-Hydroxy-4-methoxyphenyl)-6-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-ol | ChEBI |
| Citations |
|---|