EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67384 - pterolinus D
| Formula | C17H18O7 |
| Net Charge | 0 |
| Average Mass | 334.324 |
| Monoisotopic Mass | 334.10525 |
| SMILES | COC1=CC(=O)C2(C(C)C(O)c3ccc(OC)c(O)c3)OC2C1=O |
| InChI | InChI=1S/C17H18O7/c1-8(14(20)9-4-5-11(22-2)10(18)6-9)17-13(19)7-12(23-3)15(21)16(17)24-17/h4-8,14,16,18,20H,1-3H3 |
| InChIKey | XGVFUXKEPNXXRI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus santalinus (ncbitaxon:1071199) | heartwood (PO:0004512) | PubMed (21488654) | Dichloromethane soluble portion of MeOH extract of powdered heartwood |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pterolinus D (CHEBI:67384) has role anti-inflammatory agent (CHEBI:67079) |
| pterolinus D (CHEBI:67384) has role metabolite (CHEBI:25212) |
| pterolinus D (CHEBI:67384) has role plant metabolite (CHEBI:76924) |
| pterolinus D (CHEBI:67384) is a aromatic ether (CHEBI:35618) |
| pterolinus D (CHEBI:67384) is a cyclic ketone (CHEBI:3992) |
| pterolinus D (CHEBI:67384) is a epoxide (CHEBI:32955) |
| pterolinus D (CHEBI:67384) is a phenols (CHEBI:33853) |
| pterolinus D (CHEBI:67384) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-[1-hydroxy-1-(3-hydroxy-4-methoxyphenyl)propan-2-yl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548615 | Reaxys |
| Citations |
|---|