EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O5 |
| Net Charge | 0 |
| Average Mass | 316.353 |
| Monoisotopic Mass | 316.13107 |
| SMILES | COc1ccc([C@H]2Oc3cc(OC)c(OC)cc3[C@@H]2C)cc1O |
| InChI | InChI=1S/C18H20O5/c1-10-12-8-16(21-3)17(22-4)9-15(12)23-18(10)11-5-6-14(20-2)13(19)7-11/h5-10,18-19H,1-4H3/t10-,18-/m0/s1 |
| InChIKey | XZHWXGQZQLTSGY-YPMLDQLKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus santalinus (ncbitaxon:1071199) | heartwood (PO:0004512) | PubMed (21488654) | Dichloromethane soluble portion of MeOH extract of powdered heartwood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pterolinus C (CHEBI:67383) has role plant metabolite (CHEBI:76924) |
| pterolinus C (CHEBI:67383) is a 1-benzofurans (CHEBI:38830) |
| pterolinus C (CHEBI:67383) is a aromatic ether (CHEBI:35618) |
| pterolinus C (CHEBI:67383) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-[(2S,3S)-5,6-dimethoxy-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548609 | Reaxys |
| Citations |
|---|