EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | COc1ccc(-c2c(C)oc3cc(OC)c(O)cc23)cc1O |
| InChI | InChI=1S/C17H16O5/c1-9-17(10-4-5-14(20-2)12(18)6-10)11-7-13(19)16(21-3)8-15(11)22-9/h4-8,18-19H,1-3H3 |
| InChIKey | ZQLLSZOQHBGUJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus santalinus (ncbitaxon:1071199) | heartwood (PO:0004512) | PubMed (21488654) | Dichloromethane soluble portion of MeOH extract of powdered heartwood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pterolinus A (CHEBI:67381) has role anti-inflammatory agent (CHEBI:67079) |
| pterolinus A (CHEBI:67381) has role plant metabolite (CHEBI:76924) |
| pterolinus A (CHEBI:67381) is a 1-benzofurans (CHEBI:38830) |
| pterolinus A (CHEBI:67381) is a aromatic ether (CHEBI:35618) |
| pterolinus A (CHEBI:67381) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-2-methyl-1-benzofuran-5-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548611 | Reaxys |
| Citations |
|---|